C22H19FN4O3S2 — CID 55956808
N-(3-fluoro-4-imidazol-1-ylphenyl)-4-(2-thiophen-2-ylethylsulfamoyl)benzamide (PubChem CID 55956808) has the molecular formula C22H19FN4O3S2 and a molecular weight of 470.55 g/mol. Its IUPAC name is N-(3-fluoro-4-imidazol-1-ylphenyl)-4-(2-thiophen-2-ylethylsulfamoyl)benzamide.
| Compound Name | N-(3-fluoro-4-imidazol-1-ylphenyl)-4-(2-thiophen-2-ylethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 55956808 |
| Molecular Formula | C22H19FN4O3S2 |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.09 |
| IUPAC Name | N-(3-fluoro-4-imidazol-1-ylphenyl)-4-(2-thiophen-2-ylethylsulfamoyl)benzamide |
| SMILES | O=C(Nc1ccc(-n2ccnc2)c(F)c1)c1ccc(S(=O)(=O)NCCc2cccs2)cc1 |
| InChI | InChI=1S/C22H19FN4O3S2/c23-20-14-17(5-8-21(20)27-12-11-24-15-27)26-22(28)16-3-6-19(7-4-16)32(29,30)25-10-9-18-2-1-13-31-18/h1-8,11-15,25H,9-10H2,(H,26,28) |
| InChIKey | RANQMKHRKOUFTD-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |