C20H18N4O4S2 — CID 31887518
N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-4-(2-thiophen-2-ylethylsulfamoyl)benzamide (PubChem CID 31887518) has the molecular formula C20H18N4O4S2 and a molecular weight of 442.52 g/mol. Its IUPAC name is N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-4-(2-thiophen-2-ylethylsulfamoyl)benzamide.
| Compound Name | N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-4-(2-thiophen-2-ylethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 31887518 |
| Molecular Formula | C20H18N4O4S2 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-4-(2-thiophen-2-ylethylsulfamoyl)benzamide |
| SMILES | O=C(Nc1ccc2[nH]c(=O)[nH]c2c1)c1ccc(S(=O)(=O)NCCc2cccs2)cc1 |
| InChI | InChI=1S/C20H18N4O4S2/c25-19(22-14-5-8-17-18(12-14)24-20(26)23-17)13-3-6-16(7-4-13)30(27,28)21-10-9-15-2-1-11-29-15/h1-8,11-12,21H,9-10H2,(H,22,25)(H2,23,24,26) |
| InChIKey | WEUOIPXWKMZLPT-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 123.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |