C25H27N3O4S2 — CID 55959107
N-cyclopentyl-4-[[4-(2-thiophen-2-ylethylsulfamoyl)benzoyl]amino]benzamide (PubChem CID 55959107) has the molecular formula C25H27N3O4S2 and a molecular weight of 497.64 g/mol. Its IUPAC name is N-cyclopentyl-4-[[4-(2-thiophen-2-ylethylsulfamoyl)benzoyl]amino]benzamide.
| Compound Name | N-cyclopentyl-4-[[4-(2-thiophen-2-ylethylsulfamoyl)benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 55959107 |
| Molecular Formula | C25H27N3O4S2 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | N-cyclopentyl-4-[[4-(2-thiophen-2-ylethylsulfamoyl)benzoyl]amino]benzamide |
| SMILES | O=C(Nc1ccc(C(=O)NC2CCCC2)cc1)c1ccc(S(=O)(=O)NCCc2cccs2)cc1 |
| InChI | InChI=1S/C25H27N3O4S2/c29-24(27-20-4-1-2-5-20)18-7-11-21(12-8-18)28-25(30)19-9-13-23(14-10-19)34(31,32)26-16-15-22-6-3-17-33-22/h3,6-14,17,20,26H,1-2,4-5,15-16H2,(H,27,29)(H,28,30) |
| InChIKey | POUUPJYBQCTICE-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |