C20H26N2O3S2 — CID 31852345
4-[(2R)-2-ethylpiperidine-1-carbonyl]-N-(2-thiophen-2-ylethyl)benzenesulfonamide (PubChem CID 31852345) has the molecular formula C20H26N2O3S2 and a molecular weight of 406.57 g/mol. Its IUPAC name is 4-[(2R)-2-ethylpiperidine-1-carbonyl]-N-(2-thiophen-2-ylethyl)benzenesulfonamide.
| Compound Name | 4-[(2R)-2-ethylpiperidine-1-carbonyl]-N-(2-thiophen-2-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 31852345 |
| Molecular Formula | C20H26N2O3S2 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 4-[(2R)-2-ethylpiperidine-1-carbonyl]-N-(2-thiophen-2-ylethyl)benzenesulfonamide |
| SMILES | CC[C@@H]1CCCCN1C(=O)c1ccc(S(=O)(=O)NCCc2cccs2)cc1 |
| InChI | InChI=1S/C20H26N2O3S2/c1-2-17-6-3-4-14-22(17)20(23)16-8-10-19(11-9-16)27(24,25)21-13-12-18-7-5-15-26-18/h5,7-11,15,17,21H,2-4,6,12-14H2,1H3/t17-/m1/s1 |
| InChIKey | VOINVJLSCCXFBO-QGZVFWFLSA-N |
| XLogP | 3.67 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |