C18H23N3O3S2 — CID 119512591
N-(pyrrolidin-2-ylmethyl)-4-(2-thiophen-2-ylethylsulfamoyl)benzamide (PubChem CID 119512591) has the molecular formula C18H23N3O3S2 and a molecular weight of 393.53 g/mol. Its IUPAC name is N-(pyrrolidin-2-ylmethyl)-4-(2-thiophen-2-ylethylsulfamoyl)benzamide.
| Compound Name | N-(pyrrolidin-2-ylmethyl)-4-(2-thiophen-2-ylethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 119512591 |
| Molecular Formula | C18H23N3O3S2 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | N-(pyrrolidin-2-ylmethyl)-4-(2-thiophen-2-ylethylsulfamoyl)benzamide |
| SMILES | O=C(NCC1CCCN1)c1ccc(S(=O)(=O)NCCc2cccs2)cc1 |
| InChI | InChI=1S/C18H23N3O3S2/c22-18(20-13-15-3-1-10-19-15)14-5-7-17(8-6-14)26(23,24)21-11-9-16-4-2-12-25-16/h2,4-8,12,15,19,21H,1,3,9-11,13H2,(H,20,22) |
| InChIKey | FZERECFKOGSAOS-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |