C18H19N3O5S3 — CID 55835655
N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-4-(2-thiophen-2-ylethylsulfamoyl)benzamide (PubChem CID 55835655) has the molecular formula C18H19N3O5S3 and a molecular weight of 453.57 g/mol. Its IUPAC name is N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-4-(2-thiophen-2-ylethylsulfamoyl)benzamide.
| Compound Name | N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-4-(2-thiophen-2-ylethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 55835655 |
| Molecular Formula | C18H19N3O5S3 |
| Molecular Weight | 453.57 g/mol |
| Exact Mass | 453.05 |
| IUPAC Name | N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-4-(2-thiophen-2-ylethylsulfamoyl)benzamide |
| SMILES | O=C(NCCN1C(=O)CSC1=O)c1ccc(S(=O)(=O)NCCc2cccs2)cc1 |
| InChI | InChI=1S/C18H19N3O5S3/c22-16-12-28-18(24)21(16)10-9-19-17(23)13-3-5-15(6-4-13)29(25,26)20-8-7-14-2-1-11-27-14/h1-6,11,20H,7-10,12H2,(H,19,23) |
| InChIKey | YYJWTXPXZVEFLH-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.57 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|