C17H16N2O4S2 — CID 55835910
N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-3-(thiophen-2-ylmethoxy)benzamide (PubChem CID 55835910) has the molecular formula C17H16N2O4S2 and a molecular weight of 376.46 g/mol. Its IUPAC name is N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-3-(thiophen-2-ylmethoxy)benzamide.
| Compound Name | N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-3-(thiophen-2-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 55835910 |
| Molecular Formula | C17H16N2O4S2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-3-(thiophen-2-ylmethoxy)benzamide |
| SMILES | O=C(NCCN1C(=O)CSC1=O)c1cccc(OCc2cccs2)c1 |
| InChI | InChI=1S/C17H16N2O4S2/c20-15-11-25-17(22)19(15)7-6-18-16(21)12-3-1-4-13(9-12)23-10-14-5-2-8-24-14/h1-5,8-9H,6-7,10-11H2,(H,18,21) |
| InChIKey | HEBJRFYDZQSYQE-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|