C17H23ClN2O2S — CID 120651028
N-[(2R)-2-(ethylamino)propyl]-3-(thiophen-2-ylmethoxy)benzamide;hydrochloride (PubChem CID 120651028) has the molecular formula C17H23ClN2O2S and a molecular weight of 354.90 g/mol. Its IUPAC name is N-[(2R)-2-(ethylamino)propyl]-3-(thiophen-2-ylmethoxy)benzamide;hydrochloride.
| Compound Name | N-[(2R)-2-(ethylamino)propyl]-3-(thiophen-2-ylmethoxy)benzamide;hydrochloride |
|---|---|
| PubChem CID | 120651028 |
| Molecular Formula | C17H23ClN2O2S |
| Molecular Weight | 354.90 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | N-[(2R)-2-(ethylamino)propyl]-3-(thiophen-2-ylmethoxy)benzamide;hydrochloride |
| SMILES | CCN[C@H](C)CNC(=O)c1cccc(OCc2cccs2)c1.Cl |
| InChI | InChI=1S/C17H22N2O2S.ClH/c1-3-18-13(2)11-19-17(20)14-6-4-7-15(10-14)21-12-16-8-5-9-22-16;/h4-10,13,18H,3,11-12H2,1-2H3,(H,19,20);1H/t13-;/m1./s1 |
| InChIKey | NDIIQYQLNRNRFT-BTQNPOSSSA-N |
| XLogP | 3.48 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.90 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |