C23H24N2O3S — CID 55782491
N-[[3-(butanoylamino)phenyl]methyl]-3-(thiophen-2-ylmethoxy)benzamide (PubChem CID 55782491) has the molecular formula C23H24N2O3S and a molecular weight of 408.52 g/mol. Its IUPAC name is N-[[3-(butanoylamino)phenyl]methyl]-3-(thiophen-2-ylmethoxy)benzamide.
| Compound Name | N-[[3-(butanoylamino)phenyl]methyl]-3-(thiophen-2-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 55782491 |
| Molecular Formula | C23H24N2O3S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | N-[[3-(butanoylamino)phenyl]methyl]-3-(thiophen-2-ylmethoxy)benzamide |
| SMILES | CCCC(=O)Nc1cccc(CNC(=O)c2cccc(OCc3cccs3)c2)c1 |
| InChI | InChI=1S/C23H24N2O3S/c1-2-6-22(26)25-19-9-3-7-17(13-19)15-24-23(27)18-8-4-10-20(14-18)28-16-21-11-5-12-29-21/h3-5,7-14H,2,6,15-16H2,1H3,(H,24,27)(H,25,26) |
| InChIKey | ZEVFQSVEHLPXQP-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |