C18H23ClN2O2S — CID 119478873
N-(4-aminocyclohexyl)-3-(thiophen-2-ylmethoxy)benzamide;hydrochloride (PubChem CID 119478873) has the molecular formula C18H23ClN2O2S and a molecular weight of 366.91 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-3-(thiophen-2-ylmethoxy)benzamide;hydrochloride.
| Compound Name | N-(4-aminocyclohexyl)-3-(thiophen-2-ylmethoxy)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119478873 |
| Molecular Formula | C18H23ClN2O2S |
| Molecular Weight | 366.91 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | N-(4-aminocyclohexyl)-3-(thiophen-2-ylmethoxy)benzamide;hydrochloride |
| SMILES | Cl.NC1CCC(NC(=O)c2cccc(OCc3cccs3)c2)CC1 |
| InChI | InChI=1S/C18H22N2O2S.ClH/c19-14-6-8-15(9-7-14)20-18(21)13-3-1-4-16(11-13)22-12-17-5-2-10-23-17;/h1-5,10-11,14-15H,6-9,12,19H2,(H,20,21);1H |
| InChIKey | PRYPEUQNULNINE-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.91 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |