C22H29N3O3S — CID 39144071
N-[1-[2-oxo-2-(propylamino)ethyl]piperidin-4-yl]-3-(thiophen-2-ylmethoxy)benzamide (PubChem CID 39144071) has the molecular formula C22H29N3O3S and a molecular weight of 415.56 g/mol. Its IUPAC name is N-[1-[2-oxo-2-(propylamino)ethyl]piperidin-4-yl]-3-(thiophen-2-ylmethoxy)benzamide.
| Compound Name | N-[1-[2-oxo-2-(propylamino)ethyl]piperidin-4-yl]-3-(thiophen-2-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 39144071 |
| Molecular Formula | C22H29N3O3S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | N-[1-[2-oxo-2-(propylamino)ethyl]piperidin-4-yl]-3-(thiophen-2-ylmethoxy)benzamide |
| SMILES | CCCNC(=O)CN1CCC(NC(=O)c2cccc(OCc3cccs3)c2)CC1 |
| InChI | InChI=1S/C22H29N3O3S/c1-2-10-23-21(26)15-25-11-8-18(9-12-25)24-22(27)17-5-3-6-19(14-17)28-16-20-7-4-13-29-20/h3-7,13-14,18H,2,8-12,15-16H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | GGSMHEHFARYOAR-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |