C18H23N3O2S2 — CID 47548206
N-[1-[2-oxo-2-(2-thiophen-2-ylethylamino)ethyl]piperidin-4-yl]thiophene-2-carboxamide (PubChem CID 47548206) has the molecular formula C18H23N3O2S2 and a molecular weight of 377.54 g/mol. Its IUPAC name is N-[1-[2-oxo-2-(2-thiophen-2-ylethylamino)ethyl]piperidin-4-yl]thiophene-2-carboxamide.
| Compound Name | N-[1-[2-oxo-2-(2-thiophen-2-ylethylamino)ethyl]piperidin-4-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 47548206 |
| Molecular Formula | C18H23N3O2S2 |
| Molecular Weight | 377.54 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | N-[1-[2-oxo-2-(2-thiophen-2-ylethylamino)ethyl]piperidin-4-yl]thiophene-2-carboxamide |
| SMILES | O=C(CN1CCC(NC(=O)c2cccs2)CC1)NCCc1cccs1 |
| InChI | InChI=1S/C18H23N3O2S2/c22-17(19-8-5-15-3-1-11-24-15)13-21-9-6-14(7-10-21)20-18(23)16-4-2-12-25-16/h1-4,11-12,14H,5-10,13H2,(H,19,22)(H,20,23) |
| InChIKey | WHVIJXLUMXYIGH-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.54 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |