C16H22N4OS — CID 86773374
2-[4-(1H-pyrazol-4-yl)piperidin-1-yl]-N-(2-thiophen-2-ylethyl)acetamide (PubChem CID 86773374) has the molecular formula C16H22N4OS and a molecular weight of 318.45 g/mol. Its IUPAC name is 2-[4-(1H-pyrazol-4-yl)piperidin-1-yl]-N-(2-thiophen-2-ylethyl)acetamide.
| Compound Name | 2-[4-(1H-pyrazol-4-yl)piperidin-1-yl]-N-(2-thiophen-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 86773374 |
| Molecular Formula | C16H22N4OS |
| Molecular Weight | 318.45 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 2-[4-(1H-pyrazol-4-yl)piperidin-1-yl]-N-(2-thiophen-2-ylethyl)acetamide |
| SMILES | O=C(CN1CCC(c2cn[nH]c2)CC1)NCCc1cccs1 |
| InChI | InChI=1S/C16H22N4OS/c21-16(17-6-3-15-2-1-9-22-15)12-20-7-4-13(5-8-20)14-10-18-19-11-14/h1-2,9-11,13H,3-8,12H2,(H,17,21)(H,18,19) |
| InChIKey | UUPQUZJMCXEWNX-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.45 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |