C14H20N2O4S — CID 78925845
methyl 4-[2-oxo-2-(2-thiophen-2-ylethylamino)ethyl]morpholine-2-carboxylate (PubChem CID 78925845) has the molecular formula C14H20N2O4S and a molecular weight of 312.39 g/mol. Its IUPAC name is methyl 4-[2-oxo-2-(2-thiophen-2-ylethylamino)ethyl]morpholine-2-carboxylate.
| Compound Name | methyl 4-[2-oxo-2-(2-thiophen-2-ylethylamino)ethyl]morpholine-2-carboxylate |
|---|---|
| PubChem CID | 78925845 |
| Molecular Formula | C14H20N2O4S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | methyl 4-[2-oxo-2-(2-thiophen-2-ylethylamino)ethyl]morpholine-2-carboxylate |
| SMILES | COC(=O)C1CN(CC(=O)NCCc2cccs2)CCO1 |
| InChI | InChI=1S/C14H20N2O4S/c1-19-14(18)12-9-16(6-7-20-12)10-13(17)15-5-4-11-3-2-8-21-11/h2-3,8,12H,4-7,9-10H2,1H3,(H,15,17) |
| InChIKey | HPLHLIORQPYACM-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |