C25H33N3O3 — CID 39144729
3-[(3-methylphenyl)methoxy]-N-[1-[2-oxo-2-(propylamino)ethyl]piperidin-4-yl]benzamide (PubChem CID 39144729) has the molecular formula C25H33N3O3 and a molecular weight of 423.56 g/mol. Its IUPAC name is 3-[(3-methylphenyl)methoxy]-N-[1-[2-oxo-2-(propylamino)ethyl]piperidin-4-yl]benzamide.
| Compound Name | 3-[(3-methylphenyl)methoxy]-N-[1-[2-oxo-2-(propylamino)ethyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 39144729 |
| Molecular Formula | C25H33N3O3 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | 3-[(3-methylphenyl)methoxy]-N-[1-[2-oxo-2-(propylamino)ethyl]piperidin-4-yl]benzamide |
| SMILES | CCCNC(=O)CN1CCC(NC(=O)c2cccc(OCc3cccc(C)c3)c2)CC1 |
| InChI | InChI=1S/C25H33N3O3/c1-3-12-26-24(29)17-28-13-10-22(11-14-28)27-25(30)21-8-5-9-23(16-21)31-18-20-7-4-6-19(2)15-20/h4-9,15-16,22H,3,10-14,17-18H2,1-2H3,(H,26,29)(H,27,30) |
| InChIKey | LEBBTGSXMOQWMB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |