C22H27ClN2O2 — CID 119458703
N-(8-azabicyclo[3.2.1]octan-3-yl)-3-[(3-methylphenyl)methoxy]benzamide;hydrochloride (PubChem CID 119458703) has the molecular formula C22H27ClN2O2 and a molecular weight of 386.92 g/mol. Its IUPAC name is N-(8-azabicyclo[3.2.1]octan-3-yl)-3-[(3-methylphenyl)methoxy]benzamide;hydrochloride.
| Compound Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-3-[(3-methylphenyl)methoxy]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119458703 |
| Molecular Formula | C22H27ClN2O2 |
| Molecular Weight | 386.92 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-3-[(3-methylphenyl)methoxy]benzamide;hydrochloride |
| SMILES | Cc1cccc(COc2cccc(C(=O)NC3CC4CCC(C3)N4)c2)c1.Cl |
| InChI | InChI=1S/C22H26N2O2.ClH/c1-15-4-2-5-16(10-15)14-26-21-7-3-6-17(11-21)22(25)24-20-12-18-8-9-19(13-20)23-18;/h2-7,10-11,18-20,23H,8-9,12-14H2,1H3,(H,24,25);1H |
| InChIKey | BOUIFIBZGSWJNA-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.92 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |