C20H18N2O4S2 — CID 84557110
N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-3-phenacylsulfanylbenzamide (PubChem CID 84557110) has the molecular formula C20H18N2O4S2 and a molecular weight of 414.51 g/mol. Its IUPAC name is N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-3-phenacylsulfanylbenzamide.
| Compound Name | N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-3-phenacylsulfanylbenzamide |
|---|---|
| PubChem CID | 84557110 |
| Molecular Formula | C20H18N2O4S2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-3-phenacylsulfanylbenzamide |
| SMILES | O=C(CSc1cccc(C(=O)NCCN2C(=O)CSC2=O)c1)c1ccccc1 |
| InChI | InChI=1S/C20H18N2O4S2/c23-17(14-5-2-1-3-6-14)12-27-16-8-4-7-15(11-16)19(25)21-9-10-22-18(24)13-28-20(22)26/h1-8,11H,9-10,12-13H2,(H,21,25) |
| InChIKey | FYUYVLJIZCCQKS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|