C13H14N2O2S3 — CID 2625002
N-[2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)ethyl]-2-phenylsulfanylacetamide (PubChem CID 2625002) has the molecular formula C13H14N2O2S3 and a molecular weight of 326.47 g/mol. Its IUPAC name is N-[2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)ethyl]-2-phenylsulfanylacetamide.
| Compound Name | N-[2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)ethyl]-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 2625002 |
| Molecular Formula | C13H14N2O2S3 |
| Molecular Weight | 326.47 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | N-[2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)ethyl]-2-phenylsulfanylacetamide |
| SMILES | O=C(CSc1ccccc1)NCCN1C(=O)CSC1=S |
| InChI | InChI=1S/C13H14N2O2S3/c16-11(8-19-10-4-2-1-3-5-10)14-6-7-15-12(17)9-20-13(15)18/h1-5H,6-9H2,(H,14,16) |
| InChIKey | WPVFSVRRMMPMFK-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.47 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|