C13H17N5O2S3 — CID 8723501
2-[(4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-[2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)ethyl]acetamide (PubChem CID 8723501) has the molecular formula C13H17N5O2S3 and a molecular weight of 371.51 g/mol. Its IUPAC name is 2-[(4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-[2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)ethyl]acetamide.
| Compound Name | 2-[(4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-[2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 8723501 |
| Molecular Formula | C13H17N5O2S3 |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | 2-[(4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-[2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)ethyl]acetamide |
| SMILES | Cc1nnc(SCC(=O)NCCN2C(=O)CSC2=S)n1C1CC1 |
| InChI | InChI=1S/C13H17N5O2S3/c1-8-15-16-12(18(8)9-2-3-9)22-6-10(19)14-4-5-17-11(20)7-23-13(17)21/h9H,2-7H2,1H3,(H,14,19) |
| InChIKey | GGPHKUIENQQIFT-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|