C16H16N2O4S3 — CID 8627854
[2-oxo-2-[2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)ethylamino]ethyl] (E)-3-phenylsulfanylprop-2-enoate (PubChem CID 8627854) has the molecular formula C16H16N2O4S3 and a molecular weight of 396.52 g/mol. Its IUPAC name is [2-oxo-2-[2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)ethylamino]ethyl] (E)-3-phenylsulfanylprop-2-enoate.
| Compound Name | [2-oxo-2-[2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)ethylamino]ethyl] (E)-3-phenylsulfanylprop-2-enoate |
|---|---|
| PubChem CID | 8627854 |
| Molecular Formula | C16H16N2O4S3 |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.03 |
| IUPAC Name | [2-oxo-2-[2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)ethylamino]ethyl] (E)-3-phenylsulfanylprop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/Sc1ccccc1)NCCN1C(=O)CSC1=S |
| InChI | InChI=1S/C16H16N2O4S3/c19-13(17-7-8-18-14(20)11-25-16(18)23)10-22-15(21)6-9-24-12-4-2-1-3-5-12/h1-6,9H,7-8,10-11H2,(H,17,19)/b9-6+ |
| InChIKey | QQXBNAGKUIHLGQ-RMKNXTFCSA-N |
| XLogP | 1.81 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|