C18H23N3O4S2 — CID 7260755
[2-oxo-2-[2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)ethylamino]ethyl] 4-(diethylamino)benzoate (PubChem CID 7260755) has the molecular formula C18H23N3O4S2 and a molecular weight of 409.53 g/mol. Its IUPAC name is [2-oxo-2-[2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)ethylamino]ethyl] 4-(diethylamino)benzoate.
| Compound Name | [2-oxo-2-[2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)ethylamino]ethyl] 4-(diethylamino)benzoate |
|---|---|
| PubChem CID | 7260755 |
| Molecular Formula | C18H23N3O4S2 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | [2-oxo-2-[2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)ethylamino]ethyl] 4-(diethylamino)benzoate |
| SMILES | CCN(CC)c1ccc(C(=O)OCC(=O)NCCN2C(=O)CSC2=S)cc1 |
| InChI | InChI=1S/C18H23N3O4S2/c1-3-20(4-2)14-7-5-13(6-8-14)17(24)25-11-15(22)19-9-10-21-16(23)12-27-18(21)26/h5-8H,3-4,9-12H2,1-2H3,(H,19,22) |
| InChIKey | VVWNJDDFBLBZJL-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|