C15H16ClN3O4S2 — CID 8511508
[2-oxo-2-[2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)ethylamino]ethyl] 2-chloro-4,6-dimethylpyridine-3-carboxylate (PubChem CID 8511508) has the molecular formula C15H16ClN3O4S2 and a molecular weight of 401.90 g/mol. Its IUPAC name is [2-oxo-2-[2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)ethylamino]ethyl] 2-chloro-4,6-dimethylpyridine-3-carboxylate.
| Compound Name | [2-oxo-2-[2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)ethylamino]ethyl] 2-chloro-4,6-dimethylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 8511508 |
| Molecular Formula | C15H16ClN3O4S2 |
| Molecular Weight | 401.90 g/mol |
| Exact Mass | 401.03 |
| IUPAC Name | [2-oxo-2-[2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)ethylamino]ethyl] 2-chloro-4,6-dimethylpyridine-3-carboxylate |
| SMILES | Cc1cc(C)c(C(=O)OCC(=O)NCCN2C(=O)CSC2=S)c(Cl)n1 |
| InChI | InChI=1S/C15H16ClN3O4S2/c1-8-5-9(2)18-13(16)12(8)14(22)23-6-10(20)17-3-4-19-11(21)7-25-15(19)24/h5H,3-4,6-7H2,1-2H3,(H,17,20) |
| InChIKey | ZWDSVMQESQRFAY-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.90 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|