C14H15N3O5S2 — CID 9386054
[2-oxo-2-[2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)ethylamino]ethyl] 4-acetyl-1H-pyrrole-2-carboxylate (PubChem CID 9386054) has the molecular formula C14H15N3O5S2 and a molecular weight of 369.42 g/mol. Its IUPAC name is [2-oxo-2-[2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)ethylamino]ethyl] 4-acetyl-1H-pyrrole-2-carboxylate.
| Compound Name | [2-oxo-2-[2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)ethylamino]ethyl] 4-acetyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 9386054 |
| Molecular Formula | C14H15N3O5S2 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | [2-oxo-2-[2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)ethylamino]ethyl] 4-acetyl-1H-pyrrole-2-carboxylate |
| SMILES | CC(=O)c1c[nH]c(C(=O)OCC(=O)NCCN2C(=O)CSC2=S)c1 |
| InChI | InChI=1S/C14H15N3O5S2/c1-8(18)9-4-10(16-5-9)13(21)22-6-11(19)15-2-3-17-12(20)7-24-14(17)23/h4-5,16H,2-3,6-7H2,1H3,(H,15,19) |
| InChIKey | IFEBJCUPVPWKFM-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|