C13H18N2O4 — CID 9385631
[2-(tert-butylamino)-2-oxoethyl] 4-acetyl-1H-pyrrole-2-carboxylate (PubChem CID 9385631) has the molecular formula C13H18N2O4 and a molecular weight of 266.30 g/mol. Its IUPAC name is [2-(tert-butylamino)-2-oxoethyl] 4-acetyl-1H-pyrrole-2-carboxylate.
| Compound Name | [2-(tert-butylamino)-2-oxoethyl] 4-acetyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 9385631 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | [2-(tert-butylamino)-2-oxoethyl] 4-acetyl-1H-pyrrole-2-carboxylate |
| SMILES | CC(=O)c1c[nH]c(C(=O)OCC(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C13H18N2O4/c1-8(16)9-5-10(14-6-9)12(18)19-7-11(17)15-13(2,3)4/h5-6,14H,7H2,1-4H3,(H,15,17) |
| InChIKey | ACNHJMWPNNHATC-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |