C12H13N5O4S2 — CID 2625595
[2-oxo-2-[2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)ethylamino]ethyl] 3-aminopyrazine-2-carboxylate (PubChem CID 2625595) has the molecular formula C12H13N5O4S2 and a molecular weight of 355.40 g/mol. Its IUPAC name is [2-oxo-2-[2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)ethylamino]ethyl] 3-aminopyrazine-2-carboxylate.
| Compound Name | [2-oxo-2-[2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)ethylamino]ethyl] 3-aminopyrazine-2-carboxylate |
|---|---|
| PubChem CID | 2625595 |
| Molecular Formula | C12H13N5O4S2 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | [2-oxo-2-[2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)ethylamino]ethyl] 3-aminopyrazine-2-carboxylate |
| SMILES | Nc1nccnc1C(=O)OCC(=O)NCCN1C(=O)CSC1=S |
| InChI | InChI=1S/C12H13N5O4S2/c13-10-9(15-1-2-16-10)11(20)21-5-7(18)14-3-4-17-8(19)6-23-12(17)22/h1-2H,3-6H2,(H2,13,16)(H,14,18) |
| InChIKey | NMGHBRDEZAGING-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 127.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|