C17H20N2O5S2 — CID 7842006
[2-oxo-2-[2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)ethylamino]ethyl] 3-(2-methylphenoxy)propanoate (PubChem CID 7842006) has the molecular formula C17H20N2O5S2 and a molecular weight of 396.49 g/mol. Its IUPAC name is [2-oxo-2-[2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)ethylamino]ethyl] 3-(2-methylphenoxy)propanoate.
| Compound Name | [2-oxo-2-[2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)ethylamino]ethyl] 3-(2-methylphenoxy)propanoate |
|---|---|
| PubChem CID | 7842006 |
| Molecular Formula | C17H20N2O5S2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | [2-oxo-2-[2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)ethylamino]ethyl] 3-(2-methylphenoxy)propanoate |
| SMILES | Cc1ccccc1OCCC(=O)OCC(=O)NCCN1C(=O)CSC1=S |
| InChI | InChI=1S/C17H20N2O5S2/c1-12-4-2-3-5-13(12)23-9-6-16(22)24-10-14(20)18-7-8-19-15(21)11-26-17(19)25/h2-5H,6-11H2,1H3,(H,18,20) |
| InChIKey | NAZZTCCUUMUAPV-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|