C18H20N4O7S2 — CID 4830777
[2-oxo-2-[2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)ethylamino]ethyl] 4-morpholin-4-yl-3-nitrobenzoate (PubChem CID 4830777) has the molecular formula C18H20N4O7S2 and a molecular weight of 468.51 g/mol. Its IUPAC name is [2-oxo-2-[2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)ethylamino]ethyl] 4-morpholin-4-yl-3-nitrobenzoate.
| Compound Name | [2-oxo-2-[2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)ethylamino]ethyl] 4-morpholin-4-yl-3-nitrobenzoate |
|---|---|
| PubChem CID | 4830777 |
| Molecular Formula | C18H20N4O7S2 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | [2-oxo-2-[2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)ethylamino]ethyl] 4-morpholin-4-yl-3-nitrobenzoate |
| SMILES | O=C(COC(=O)c1ccc(N2CCOCC2)c([N+](=O)[O-])c1)NCCN1C(=O)CSC1=S |
| InChI | InChI=1S/C18H20N4O7S2/c23-15(19-3-4-21-16(24)11-31-18(21)30)10-29-17(25)12-1-2-13(14(9-12)22(26)27)20-5-7-28-8-6-20/h1-2,9H,3-8,10-11H2,(H,19,23) |
| InChIKey | IQGFWFDJNYUTRG-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 131.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|