C12H10Br2N2O3S — CID 114370897
2,5-dibromo-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]benzamide (PubChem CID 114370897) has the molecular formula C12H10Br2N2O3S and a molecular weight of 422.10 g/mol. Its IUPAC name is 2,5-dibromo-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]benzamide.
| Compound Name | 2,5-dibromo-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 114370897 |
| Molecular Formula | C12H10Br2N2O3S |
| Molecular Weight | 422.10 g/mol |
| Exact Mass | 419.88 |
| IUPAC Name | 2,5-dibromo-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]benzamide |
| SMILES | O=C(NCCN1C(=O)CSC1=O)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C12H10Br2N2O3S/c13-7-1-2-9(14)8(5-7)11(18)15-3-4-16-10(17)6-20-12(16)19/h1-2,5H,3-4,6H2,(H,15,18) |
| InChIKey | DZMWDBKOOBBMQN-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.10 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|