C14H13N3O3S — CID 82179048
3-(cyanomethyl)-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]benzamide (PubChem CID 82179048) has the molecular formula C14H13N3O3S and a molecular weight of 303.34 g/mol. Its IUPAC name is 3-(cyanomethyl)-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]benzamide.
| Compound Name | 3-(cyanomethyl)-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 82179048 |
| Molecular Formula | C14H13N3O3S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 3-(cyanomethyl)-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]benzamide |
| SMILES | N#CCc1cccc(C(=O)NCCN2C(=O)CSC2=O)c1 |
| InChI | InChI=1S/C14H13N3O3S/c15-5-4-10-2-1-3-11(8-10)13(19)16-6-7-17-12(18)9-21-14(17)20/h1-3,8H,4,6-7,9H2,(H,16,19) |
| InChIKey | KPEVVOKZKBLCEM-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|