C16H24N2O4S — CID 51297166
N-cyclohexyl-4-(2-methoxyethylsulfamoyl)benzamide (PubChem CID 51297166) has the molecular formula C16H24N2O4S and a molecular weight of 340.45 g/mol. Its IUPAC name is N-cyclohexyl-4-(2-methoxyethylsulfamoyl)benzamide.
| Compound Name | N-cyclohexyl-4-(2-methoxyethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 51297166 |
| Molecular Formula | C16H24N2O4S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | N-cyclohexyl-4-(2-methoxyethylsulfamoyl)benzamide |
| SMILES | COCCNS(=O)(=O)c1ccc(C(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C16H24N2O4S/c1-22-12-11-17-23(20,21)15-9-7-13(8-10-15)16(19)18-14-5-3-2-4-6-14/h7-10,14,17H,2-6,11-12H2,1H3,(H,18,19) |
| InChIKey | QYAKLRJZFKSGJQ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|