C17H26N2O4S — CID 17464043
4-(2-methoxyethylsulfamoyl)-N-(2-methylcyclohexyl)benzamide (PubChem CID 17464043) has the molecular formula C17H26N2O4S and a molecular weight of 354.47 g/mol. Its IUPAC name is 4-(2-methoxyethylsulfamoyl)-N-(2-methylcyclohexyl)benzamide.
| Compound Name | 4-(2-methoxyethylsulfamoyl)-N-(2-methylcyclohexyl)benzamide |
|---|---|
| PubChem CID | 17464043 |
| Molecular Formula | C17H26N2O4S |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 4-(2-methoxyethylsulfamoyl)-N-(2-methylcyclohexyl)benzamide |
| SMILES | COCCNS(=O)(=O)c1ccc(C(=O)NC2CCCCC2C)cc1 |
| InChI | InChI=1S/C17H26N2O4S/c1-13-5-3-4-6-16(13)19-17(20)14-7-9-15(10-8-14)24(21,22)18-11-12-23-2/h7-10,13,16,18H,3-6,11-12H2,1-2H3,(H,19,20) |
| InChIKey | NSBXXHICALXSDK-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|