C16H25N3O4S — CID 120574271
4-(2-methoxyethylsulfamoyl)-N-(2-methylpiperidin-3-yl)benzamide (PubChem CID 120574271) has the molecular formula C16H25N3O4S and a molecular weight of 355.46 g/mol. Its IUPAC name is 4-(2-methoxyethylsulfamoyl)-N-(2-methylpiperidin-3-yl)benzamide.
| Compound Name | 4-(2-methoxyethylsulfamoyl)-N-(2-methylpiperidin-3-yl)benzamide |
|---|---|
| PubChem CID | 120574271 |
| Molecular Formula | C16H25N3O4S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 4-(2-methoxyethylsulfamoyl)-N-(2-methylpiperidin-3-yl)benzamide |
| SMILES | COCCNS(=O)(=O)c1ccc(C(=O)NC2CCCNC2C)cc1 |
| InChI | InChI=1S/C16H25N3O4S/c1-12-15(4-3-9-17-12)19-16(20)13-5-7-14(8-6-13)24(21,22)18-10-11-23-2/h5-8,12,15,17-18H,3-4,9-11H2,1-2H3,(H,19,20) |
| InChIKey | UPEBHQUJQCACOE-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|