C16H24N2O3S — CID 18106170
4-(tert-butylsulfamoyl)-N-cyclopentylbenzamide (PubChem CID 18106170) has the molecular formula C16H24N2O3S and a molecular weight of 324.45 g/mol. Its IUPAC name is 4-(tert-butylsulfamoyl)-N-cyclopentylbenzamide.
| Compound Name | 4-(tert-butylsulfamoyl)-N-cyclopentylbenzamide |
|---|---|
| PubChem CID | 18106170 |
| Molecular Formula | C16H24N2O3S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 4-(tert-butylsulfamoyl)-N-cyclopentylbenzamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccc(C(=O)NC2CCCC2)cc1 |
| InChI | InChI=1S/C16H24N2O3S/c1-16(2,3)18-22(20,21)14-10-8-12(9-11-14)15(19)17-13-6-4-5-7-13/h8-11,13,18H,4-7H2,1-3H3,(H,17,19) |
| InChIKey | FGLUZFIFCZEVQH-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |