C17H17FNO4S- — CID 9160269
3-[2-(4-ethylphenyl)ethylsulfamoyl]-4-fluorobenzoate (PubChem CID 9160269) has the molecular formula C17H17FNO4S- and a molecular weight of 350.39 g/mol. Its IUPAC name is 3-[2-(4-ethylphenyl)ethylsulfamoyl]-4-fluorobenzoate.
| Compound Name | 3-[2-(4-ethylphenyl)ethylsulfamoyl]-4-fluorobenzoate |
|---|---|
| PubChem CID | 9160269 |
| Molecular Formula | C17H17FNO4S- |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 3-[2-(4-ethylphenyl)ethylsulfamoyl]-4-fluorobenzoate |
| SMILES | CCc1ccc(CCNS(=O)(=O)c2cc(C(=O)[O-])ccc2F)cc1 |
| InChI | InChI=1S/C17H18FNO4S/c1-2-12-3-5-13(6-4-12)9-10-19-24(22,23)16-11-14(17(20)21)7-8-15(16)18/h3-8,11,19H,2,9-10H2,1H3,(H,20,21)/p-1 |
| InChIKey | ZMZGUXYJJILYMQ-UHFFFAOYSA-M |
| XLogP | 1.27 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |