C16H15FNO5S- — CID 9160178
3-[(4-ethoxyphenyl)methylsulfamoyl]-4-fluorobenzoate (PubChem CID 9160178) has the molecular formula C16H15FNO5S- and a molecular weight of 352.36 g/mol. Its IUPAC name is 3-[(4-ethoxyphenyl)methylsulfamoyl]-4-fluorobenzoate.
| Compound Name | 3-[(4-ethoxyphenyl)methylsulfamoyl]-4-fluorobenzoate |
|---|---|
| PubChem CID | 9160178 |
| Molecular Formula | C16H15FNO5S- |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 3-[(4-ethoxyphenyl)methylsulfamoyl]-4-fluorobenzoate |
| SMILES | CCOc1ccc(CNS(=O)(=O)c2cc(C(=O)[O-])ccc2F)cc1 |
| InChI | InChI=1S/C16H16FNO5S/c1-2-23-13-6-3-11(4-7-13)10-18-24(21,22)15-9-12(16(19)20)5-8-14(15)17/h3-9,18H,2,10H2,1H3,(H,19,20)/p-1 |
| InChIKey | NCUWWJFGWPRYHI-UHFFFAOYSA-M |
| XLogP | 1.07 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |