C12H18FNO3S — CID 164769264
N-tert-butyl-5-ethoxy-2-fluorobenzenesulfonamide (PubChem CID 164769264) has the molecular formula C12H18FNO3S and a molecular weight of 275.35 g/mol. Its IUPAC name is N-tert-butyl-5-ethoxy-2-fluorobenzenesulfonamide.
| Compound Name | N-tert-butyl-5-ethoxy-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 164769264 |
| Molecular Formula | C12H18FNO3S |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | N-tert-butyl-5-ethoxy-2-fluorobenzenesulfonamide |
| SMILES | CCOc1ccc(F)c(S(=O)(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C12H18FNO3S/c1-5-17-9-6-7-10(13)11(8-9)18(15,16)14-12(2,3)4/h6-8,14H,5H2,1-4H3 |
| InChIKey | UJJVXTJTXJIZGR-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |