C19H21FNO5S- — CID 9159987
4-fluoro-3-[2-(3-methyl-4-propan-2-ylphenoxy)ethylsulfamoyl]benzoate (PubChem CID 9159987) has the molecular formula C19H21FNO5S- and a molecular weight of 394.44 g/mol. Its IUPAC name is 4-fluoro-3-[2-(3-methyl-4-propan-2-ylphenoxy)ethylsulfamoyl]benzoate.
| Compound Name | 4-fluoro-3-[2-(3-methyl-4-propan-2-ylphenoxy)ethylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 9159987 |
| Molecular Formula | C19H21FNO5S- |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 4-fluoro-3-[2-(3-methyl-4-propan-2-ylphenoxy)ethylsulfamoyl]benzoate |
| SMILES | Cc1cc(OCCNS(=O)(=O)c2cc(C(=O)[O-])ccc2F)ccc1C(C)C |
| InChI | InChI=1S/C19H22FNO5S/c1-12(2)16-6-5-15(10-13(16)3)26-9-8-21-27(24,25)18-11-14(19(22)23)4-7-17(18)20/h4-7,10-12,21H,8-9H2,1-3H3,(H,22,23)/p-1 |
| InChIKey | GPIKSHHPSJFSAT-UHFFFAOYSA-M |
| XLogP | 1.98 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|