C15H11FNO6S- — CID 9160469
3-(1,3-benzodioxol-5-ylmethylsulfamoyl)-4-fluorobenzoate (PubChem CID 9160469) has the molecular formula C15H11FNO6S- and a molecular weight of 352.32 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylmethylsulfamoyl)-4-fluorobenzoate.
| Compound Name | 3-(1,3-benzodioxol-5-ylmethylsulfamoyl)-4-fluorobenzoate |
|---|---|
| PubChem CID | 9160469 |
| Molecular Formula | C15H11FNO6S- |
| Molecular Weight | 352.32 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylmethylsulfamoyl)-4-fluorobenzoate |
| SMILES | O=C([O-])c1ccc(F)c(S(=O)(=O)NCc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C15H12FNO6S/c16-11-3-2-10(15(18)19)6-14(11)24(20,21)17-7-9-1-4-12-13(5-9)23-8-22-12/h1-6,17H,7-8H2,(H,18,19)/p-1 |
| InChIKey | IGBKIFAMPXDHJG-UHFFFAOYSA-M |
| XLogP | 0.40 |
| TPSA | 104.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.32 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |