C17H15FNO6S- — CID 9160397
3-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylsulfamoyl]-4-fluorobenzoate (PubChem CID 9160397) has the molecular formula C17H15FNO6S- and a molecular weight of 380.37 g/mol. Its IUPAC name is 3-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylsulfamoyl]-4-fluorobenzoate.
| Compound Name | 3-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylsulfamoyl]-4-fluorobenzoate |
|---|---|
| PubChem CID | 9160397 |
| Molecular Formula | C17H15FNO6S- |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | 3-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylsulfamoyl]-4-fluorobenzoate |
| SMILES | O=C([O-])c1ccc(F)c(S(=O)(=O)NCCc2ccc3c(c2)OCCO3)c1 |
| InChI | InChI=1S/C17H16FNO6S/c18-13-3-2-12(17(20)21)10-16(13)26(22,23)19-6-5-11-1-4-14-15(9-11)25-8-7-24-14/h1-4,9-10,19H,5-8H2,(H,20,21)/p-1 |
| InChIKey | WNCRCUZTXCJEJC-UHFFFAOYSA-M |
| XLogP | 0.48 |
| TPSA | 104.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |