C15H13Cl2NO5S — CID 4524167
N-[2-(1,3-benzodioxol-5-yl)ethyl]-3,5-dichloro-2-hydroxybenzenesulfonamide (PubChem CID 4524167) has the molecular formula C15H13Cl2NO5S and a molecular weight of 390.24 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yl)ethyl]-3,5-dichloro-2-hydroxybenzenesulfonamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-3,5-dichloro-2-hydroxybenzenesulfonamide |
|---|---|
| PubChem CID | 4524167 |
| Molecular Formula | C15H13Cl2NO5S |
| Molecular Weight | 390.24 g/mol |
| Exact Mass | 388.99 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-3,5-dichloro-2-hydroxybenzenesulfonamide |
| SMILES | O=S(=O)(NCCc1ccc2c(c1)OCO2)c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C15H13Cl2NO5S/c16-10-6-11(17)15(19)14(7-10)24(20,21)18-4-3-9-1-2-12-13(5-9)23-8-22-12/h1-2,5-7,18-19H,3-4,8H2 |
| InChIKey | DEZYJWMFJFKOHE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.24 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfonamide_A(43)', 'substructure': 'N/A'} |
|---|