C15H13Cl2NO5S — CID 3875916
N-(1,3-benzodioxol-5-yl)-3,5-dichloro-N-ethyl-2-hydroxybenzenesulfonamide (PubChem CID 3875916) has the molecular formula C15H13Cl2NO5S and a molecular weight of 390.24 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-3,5-dichloro-N-ethyl-2-hydroxybenzenesulfonamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-3,5-dichloro-N-ethyl-2-hydroxybenzenesulfonamide |
|---|---|
| PubChem CID | 3875916 |
| Molecular Formula | C15H13Cl2NO5S |
| Molecular Weight | 390.24 g/mol |
| Exact Mass | 388.99 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-3,5-dichloro-N-ethyl-2-hydroxybenzenesulfonamide |
| SMILES | CCN(c1ccc2c(c1)OCO2)S(=O)(=O)c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C15H13Cl2NO5S/c1-2-18(10-3-4-12-13(7-10)23-8-22-12)24(20,21)14-6-9(16)5-11(17)15(14)19/h3-7,19H,2,8H2,1H3 |
| InChIKey | HALWLPGDVSXVBN-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.24 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfonamide_A(43)', 'substructure': 'N/A'} |
|---|