C15H14FNO4S — CID 3434417
N-(1,3-benzodioxol-5-yl)-N-ethyl-2-fluorobenzenesulfonamide (PubChem CID 3434417) has the molecular formula C15H14FNO4S and a molecular weight of 323.35 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-N-ethyl-2-fluorobenzenesulfonamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-N-ethyl-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 3434417 |
| Molecular Formula | C15H14FNO4S |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-N-ethyl-2-fluorobenzenesulfonamide |
| SMILES | CCN(c1ccc2c(c1)OCO2)S(=O)(=O)c1ccccc1F |
| InChI | InChI=1S/C15H14FNO4S/c1-2-17(11-7-8-13-14(9-11)21-10-20-13)22(18,19)15-6-4-3-5-12(15)16/h3-9H,2,10H2,1H3 |
| InChIKey | TUVUJBVCSXICJB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |