C14H21NO6S — CID 10568486
N-(1,3-benzodioxol-5-yl)-N-(2,2-diethoxyethyl)methanesulfonamide (PubChem CID 10568486) has the molecular formula C14H21NO6S and a molecular weight of 331.39 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-N-(2,2-diethoxyethyl)methanesulfonamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-N-(2,2-diethoxyethyl)methanesulfonamide |
|---|---|
| PubChem CID | 10568486 |
| Molecular Formula | C14H21NO6S |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-N-(2,2-diethoxyethyl)methanesulfonamide |
| SMILES | CCOC(CN(c1ccc2c(c1)OCO2)S(C)(=O)=O)OCC |
| InChI | InChI=1S/C14H21NO6S/c1-4-18-14(19-5-2)9-15(22(3,16)17)11-6-7-12-13(8-11)21-10-20-12/h6-8,14H,4-5,9-10H2,1-3H3 |
| InChIKey | BGKGZDNXQSQFGV-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|