C17H28ClNO4S — CID 10833476
N-(4-tert-butyl-3-chlorophenyl)-N-(2,2-diethoxyethyl)methanesulfonamide (PubChem CID 10833476) has the molecular formula C17H28ClNO4S and a molecular weight of 377.93 g/mol. Its IUPAC name is N-(4-tert-butyl-3-chlorophenyl)-N-(2,2-diethoxyethyl)methanesulfonamide.
| Compound Name | N-(4-tert-butyl-3-chlorophenyl)-N-(2,2-diethoxyethyl)methanesulfonamide |
|---|---|
| PubChem CID | 10833476 |
| Molecular Formula | C17H28ClNO4S |
| Molecular Weight | 377.93 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | N-(4-tert-butyl-3-chlorophenyl)-N-(2,2-diethoxyethyl)methanesulfonamide |
| SMILES | CCOC(CN(c1ccc(C(C)(C)C)c(Cl)c1)S(C)(=O)=O)OCC |
| InChI | InChI=1S/C17H28ClNO4S/c1-7-22-16(23-8-2)12-19(24(6,20)21)13-9-10-14(15(18)11-13)17(3,4)5/h9-11,16H,7-8,12H2,1-6H3 |
| InChIKey | FMNVKJHYOPPTOT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.93 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|