C12H16ClFN2O4S — CID 113070202
ethyl N-[2-(3-chloro-4-fluoro-N-methylsulfonylanilino)ethyl]carbamate (PubChem CID 113070202) has the molecular formula C12H16ClFN2O4S and a molecular weight of 338.79 g/mol. Its IUPAC name is ethyl N-[2-(3-chloro-4-fluoro-N-methylsulfonylanilino)ethyl]carbamate.
| Compound Name | ethyl N-[2-(3-chloro-4-fluoro-N-methylsulfonylanilino)ethyl]carbamate |
|---|---|
| PubChem CID | 113070202 |
| Molecular Formula | C12H16ClFN2O4S |
| Molecular Weight | 338.79 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | ethyl N-[2-(3-chloro-4-fluoro-N-methylsulfonylanilino)ethyl]carbamate |
| SMILES | CCOC(=O)NCCN(c1ccc(F)c(Cl)c1)S(C)(=O)=O |
| InChI | InChI=1S/C12H16ClFN2O4S/c1-3-20-12(17)15-6-7-16(21(2,18)19)9-4-5-11(14)10(13)8-9/h4-5,8H,3,6-7H2,1-2H3,(H,15,17) |
| InChIKey | YHOVTOBQRKWQDG-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.79 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |