C13H20N2O4S — CID 113068739
ethyl N-[2-(4-methyl-N-methylsulfonylanilino)ethyl]carbamate (PubChem CID 113068739) has the molecular formula C13H20N2O4S and a molecular weight of 300.38 g/mol. Its IUPAC name is ethyl N-[2-(4-methyl-N-methylsulfonylanilino)ethyl]carbamate.
| Compound Name | ethyl N-[2-(4-methyl-N-methylsulfonylanilino)ethyl]carbamate |
|---|---|
| PubChem CID | 113068739 |
| Molecular Formula | C13H20N2O4S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | ethyl N-[2-(4-methyl-N-methylsulfonylanilino)ethyl]carbamate |
| SMILES | CCOC(=O)NCCN(c1ccc(C)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C13H20N2O4S/c1-4-19-13(16)14-9-10-15(20(3,17)18)12-7-5-11(2)6-8-12/h5-8H,4,9-10H2,1-3H3,(H,14,16) |
| InChIKey | LQGYPYXCEOIKTR-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |