C13H17N3O4S — CID 113072200
ethyl N-[2-(2-cyano-N-methylsulfonylanilino)ethyl]carbamate (PubChem CID 113072200) has the molecular formula C13H17N3O4S and a molecular weight of 311.36 g/mol. Its IUPAC name is ethyl N-[2-(2-cyano-N-methylsulfonylanilino)ethyl]carbamate.
| Compound Name | ethyl N-[2-(2-cyano-N-methylsulfonylanilino)ethyl]carbamate |
|---|---|
| PubChem CID | 113072200 |
| Molecular Formula | C13H17N3O4S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | ethyl N-[2-(2-cyano-N-methylsulfonylanilino)ethyl]carbamate |
| SMILES | CCOC(=O)NCCN(c1ccccc1C#N)S(C)(=O)=O |
| InChI | InChI=1S/C13H17N3O4S/c1-3-20-13(17)15-8-9-16(21(2,18)19)12-7-5-4-6-11(12)10-14/h4-7H,3,8-9H2,1-2H3,(H,15,17) |
| InChIKey | UGENZPHIKNGVMI-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |