C14H18N4O3S — CID 113072205
1-[2-(2-cyano-N-methylsulfonylanilino)ethyl]-3-cyclopropylurea (PubChem CID 113072205) has the molecular formula C14H18N4O3S and a molecular weight of 322.39 g/mol. Its IUPAC name is 1-[2-(2-cyano-N-methylsulfonylanilino)ethyl]-3-cyclopropylurea.
| Compound Name | 1-[2-(2-cyano-N-methylsulfonylanilino)ethyl]-3-cyclopropylurea |
|---|---|
| PubChem CID | 113072205 |
| Molecular Formula | C14H18N4O3S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 1-[2-(2-cyano-N-methylsulfonylanilino)ethyl]-3-cyclopropylurea |
| SMILES | CS(=O)(=O)N(CCNC(=O)NC1CC1)c1ccccc1C#N |
| InChI | InChI=1S/C14H18N4O3S/c1-22(20,21)18(13-5-3-2-4-11(13)10-15)9-8-16-14(19)17-12-6-7-12/h2-5,12H,6-9H2,1H3,(H2,16,17,19) |
| InChIKey | GARZFHJPHZHVOJ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |