C14H20BrN3O3S — CID 113071624
1-[2-(4-bromo-3-methyl-N-methylsulfonylanilino)ethyl]-3-cyclopropylurea (PubChem CID 113071624) has the molecular formula C14H20BrN3O3S and a molecular weight of 390.30 g/mol. Its IUPAC name is 1-[2-(4-bromo-3-methyl-N-methylsulfonylanilino)ethyl]-3-cyclopropylurea.
| Compound Name | 1-[2-(4-bromo-3-methyl-N-methylsulfonylanilino)ethyl]-3-cyclopropylurea |
|---|---|
| PubChem CID | 113071624 |
| Molecular Formula | C14H20BrN3O3S |
| Molecular Weight | 390.30 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | 1-[2-(4-bromo-3-methyl-N-methylsulfonylanilino)ethyl]-3-cyclopropylurea |
| SMILES | Cc1cc(N(CCNC(=O)NC2CC2)S(C)(=O)=O)ccc1Br |
| InChI | InChI=1S/C14H20BrN3O3S/c1-10-9-12(5-6-13(10)15)18(22(2,20)21)8-7-16-14(19)17-11-3-4-11/h5-6,9,11H,3-4,7-8H2,1-2H3,(H2,16,17,19) |
| InChIKey | CYOPDWAFPTWLLI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.30 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |