C15H21BrN2O3S — CID 113071622
N-[2-(4-bromo-3-methyl-N-methylsulfonylanilino)ethyl]cyclobutanecarboxamide (PubChem CID 113071622) has the molecular formula C15H21BrN2O3S and a molecular weight of 389.32 g/mol. Its IUPAC name is N-[2-(4-bromo-3-methyl-N-methylsulfonylanilino)ethyl]cyclobutanecarboxamide.
| Compound Name | N-[2-(4-bromo-3-methyl-N-methylsulfonylanilino)ethyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 113071622 |
| Molecular Formula | C15H21BrN2O3S |
| Molecular Weight | 389.32 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | N-[2-(4-bromo-3-methyl-N-methylsulfonylanilino)ethyl]cyclobutanecarboxamide |
| SMILES | Cc1cc(N(CCNC(=O)C2CCC2)S(C)(=O)=O)ccc1Br |
| InChI | InChI=1S/C15H21BrN2O3S/c1-11-10-13(6-7-14(11)16)18(22(2,20)21)9-8-17-15(19)12-4-3-5-12/h6-7,10,12H,3-5,8-9H2,1-2H3,(H,17,19) |
| InChIKey | FEMNJLOHHVJEHC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |